C17H29N3O5 — CID 8754691
methyl 1-[2-[(1-ethoxycarbonylpiperidin-4-yl)amino]-2-oxoethyl]piperidine-4-carboxylate (PubChem CID 8754691) has the molecular formula C17H29N3O5 and a molecular weight of 355.44 g/mol. Its IUPAC name is methyl 1-[2-[(1-ethoxycarbonylpiperidin-4-yl)amino]-2-oxoethyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-[(1-ethoxycarbonylpiperidin-4-yl)amino]-2-oxoethyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 8754691 |
| Molecular Formula | C17H29N3O5 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | methyl 1-[2-[(1-ethoxycarbonylpiperidin-4-yl)amino]-2-oxoethyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)CN2CCC(C(=O)OC)CC2)CC1 |
| InChI | InChI=1S/C17H29N3O5/c1-3-25-17(23)20-10-6-14(7-11-20)18-15(21)12-19-8-4-13(5-9-19)16(22)24-2/h13-14H,3-12H2,1-2H3,(H,18,21) |
| InChIKey | NYQRWYCBAKEKKZ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |