C17H30N4O4 — CID 108944536
ethyl 4-[[3-(4-ethylpiperazin-1-yl)-3-oxopropanoyl]amino]piperidine-1-carboxylate (PubChem CID 108944536) has the molecular formula C17H30N4O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is ethyl 4-[[3-(4-ethylpiperazin-1-yl)-3-oxopropanoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[3-(4-ethylpiperazin-1-yl)-3-oxopropanoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108944536 |
| Molecular Formula | C17H30N4O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | ethyl 4-[[3-(4-ethylpiperazin-1-yl)-3-oxopropanoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)CC(=O)N2CCN(CC)CC2)CC1 |
| InChI | InChI=1S/C17H30N4O4/c1-3-19-9-11-20(12-10-19)16(23)13-15(22)18-14-5-7-21(8-6-14)17(24)25-4-2/h14H,3-13H2,1-2H3,(H,18,22) |
| InChIKey | IHSIBRCWLVNFOT-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|