C13H21N3O4 — CID 108941022
ethyl 4-[3-(cyclopropylamino)-3-oxopropanoyl]piperazine-1-carboxylate (PubChem CID 108941022) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is ethyl 4-[3-(cyclopropylamino)-3-oxopropanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-(cyclopropylamino)-3-oxopropanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108941022 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | ethyl 4-[3-(cyclopropylamino)-3-oxopropanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CC(=O)NC2CC2)CC1 |
| InChI | InChI=1S/C13H21N3O4/c1-2-20-13(19)16-7-5-15(6-8-16)12(18)9-11(17)14-10-3-4-10/h10H,2-9H2,1H3,(H,14,17) |
| InChIKey | SXFWFQQLPLMVPB-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|