C15H25N3O4 — CID 113165659
ethyl 4-[acetyl-[2-(cyclopropylamino)-2-oxoethyl]amino]piperidine-1-carboxylate (PubChem CID 113165659) has the molecular formula C15H25N3O4 and a molecular weight of 311.38 g/mol. Its IUPAC name is ethyl 4-[acetyl-[2-(cyclopropylamino)-2-oxoethyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[acetyl-[2-(cyclopropylamino)-2-oxoethyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 113165659 |
| Molecular Formula | C15H25N3O4 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | ethyl 4-[acetyl-[2-(cyclopropylamino)-2-oxoethyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N(CC(=O)NC2CC2)C(C)=O)CC1 |
| InChI | InChI=1S/C15H25N3O4/c1-3-22-15(21)17-8-6-13(7-9-17)18(11(2)19)10-14(20)16-12-4-5-12/h12-13H,3-10H2,1-2H3,(H,16,20) |
| InChIKey | DRFMESGPKQTVLJ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |