C18H32N4O5 — CID 113160641
ethyl 4-[[2-[acetyl(2-morpholin-4-ylethyl)amino]acetyl]amino]piperidine-1-carboxylate (PubChem CID 113160641) has the molecular formula C18H32N4O5 and a molecular weight of 384.48 g/mol. Its IUPAC name is ethyl 4-[[2-[acetyl(2-morpholin-4-ylethyl)amino]acetyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-[acetyl(2-morpholin-4-ylethyl)amino]acetyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 113160641 |
| Molecular Formula | C18H32N4O5 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | ethyl 4-[[2-[acetyl(2-morpholin-4-ylethyl)amino]acetyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)CN(CCN2CCOCC2)C(C)=O)CC1 |
| InChI | InChI=1S/C18H32N4O5/c1-3-27-18(25)21-6-4-16(5-7-21)19-17(24)14-22(15(2)23)9-8-20-10-12-26-13-11-20/h16H,3-14H2,1-2H3,(H,19,24) |
| InChIKey | WZTVKUHOLVCTIS-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |