C18H25N3O4 — CID 113167125
ethyl 4-[[2-(N-acetylanilino)acetyl]amino]piperidine-1-carboxylate (PubChem CID 113167125) has the molecular formula C18H25N3O4 and a molecular weight of 347.41 g/mol. Its IUPAC name is ethyl 4-[[2-(N-acetylanilino)acetyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-(N-acetylanilino)acetyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 113167125 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | ethyl 4-[[2-(N-acetylanilino)acetyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)CN(C(C)=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H25N3O4/c1-3-25-18(24)20-11-9-15(10-12-20)19-17(23)13-21(14(2)22)16-7-5-4-6-8-16/h4-8,15H,3,9-13H2,1-2H3,(H,19,23) |
| InChIKey | ICPYBKRAXBPDHR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |