C21H31N3O4 — CID 113125386
ethyl 4-[3-(N-acetyl-4-ethylanilino)propanoylamino]piperidine-1-carboxylate (PubChem CID 113125386) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is ethyl 4-[3-(N-acetyl-4-ethylanilino)propanoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[3-(N-acetyl-4-ethylanilino)propanoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 113125386 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | ethyl 4-[3-(N-acetyl-4-ethylanilino)propanoylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)CCN(C(C)=O)c2ccc(CC)cc2)CC1 |
| InChI | InChI=1S/C21H31N3O4/c1-4-17-6-8-19(9-7-17)24(16(3)25)15-12-20(26)22-18-10-13-23(14-11-18)21(27)28-5-2/h6-9,18H,4-5,10-15H2,1-3H3,(H,22,26) |
| InChIKey | SMPAERJTGVNQEA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |