C16H29N3O4 — CID 113056358
ethyl 4-[acetyl-[2-(2-methylpropanoylamino)ethyl]amino]piperidine-1-carboxylate (PubChem CID 113056358) has the molecular formula C16H29N3O4 and a molecular weight of 327.43 g/mol. Its IUPAC name is ethyl 4-[acetyl-[2-(2-methylpropanoylamino)ethyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[acetyl-[2-(2-methylpropanoylamino)ethyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 113056358 |
| Molecular Formula | C16H29N3O4 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | ethyl 4-[acetyl-[2-(2-methylpropanoylamino)ethyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N(CCNC(=O)C(C)C)C(C)=O)CC1 |
| InChI | InChI=1S/C16H29N3O4/c1-5-23-16(22)18-9-6-14(7-10-18)19(13(4)20)11-8-17-15(21)12(2)3/h12,14H,5-11H2,1-4H3,(H,17,21) |
| InChIKey | FGSBIHBAOSNMFE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |