C15H27N3O4 — CID 31011883
ethyl 4-[2-(2-methylpropanoylamino)ethylcarbamoyl]piperidine-1-carboxylate (PubChem CID 31011883) has the molecular formula C15H27N3O4 and a molecular weight of 313.40 g/mol. Its IUPAC name is ethyl 4-[2-(2-methylpropanoylamino)ethylcarbamoyl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[2-(2-methylpropanoylamino)ethylcarbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 31011883 |
| Molecular Formula | C15H27N3O4 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | ethyl 4-[2-(2-methylpropanoylamino)ethylcarbamoyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(C(=O)NCCNC(=O)C(C)C)CC1 |
| InChI | InChI=1S/C15H27N3O4/c1-4-22-15(21)18-9-5-12(6-10-18)14(20)17-8-7-16-13(19)11(2)3/h11-12H,4-10H2,1-3H3,(H,16,19)(H,17,20) |
| InChIKey | UUNYEHQGWGMNGD-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|