C15H27N3O5S — CID 113067911
ethyl 4-[2-(cyclopropanecarbonylamino)ethyl-methylsulfonylamino]piperidine-1-carboxylate (PubChem CID 113067911) has the molecular formula C15H27N3O5S and a molecular weight of 361.46 g/mol. Its IUPAC name is ethyl 4-[2-(cyclopropanecarbonylamino)ethyl-methylsulfonylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[2-(cyclopropanecarbonylamino)ethyl-methylsulfonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 113067911 |
| Molecular Formula | C15H27N3O5S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | ethyl 4-[2-(cyclopropanecarbonylamino)ethyl-methylsulfonylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N(CCNC(=O)C2CC2)S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C15H27N3O5S/c1-3-23-15(20)17-9-6-13(7-10-17)18(24(2,21)22)11-8-16-14(19)12-4-5-12/h12-13H,3-11H2,1-2H3,(H,16,19) |
| InChIKey | SVEDLJSWOKZFTK-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |