C17H33N3O5S — CID 113067916
ethyl 4-[2-(2-ethylbutanoylamino)ethyl-methylsulfonylamino]piperidine-1-carboxylate (PubChem CID 113067916) has the molecular formula C17H33N3O5S and a molecular weight of 391.53 g/mol. Its IUPAC name is ethyl 4-[2-(2-ethylbutanoylamino)ethyl-methylsulfonylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[2-(2-ethylbutanoylamino)ethyl-methylsulfonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 113067916 |
| Molecular Formula | C17H33N3O5S |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | ethyl 4-[2-(2-ethylbutanoylamino)ethyl-methylsulfonylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N(CCNC(=O)C(CC)CC)S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C17H33N3O5S/c1-5-14(6-2)16(21)18-10-13-20(26(4,23)24)15-8-11-19(12-9-15)17(22)25-7-3/h14-15H,5-13H2,1-4H3,(H,18,21) |
| InChIKey | CUFCVGGXSLFWES-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |