C19H33N3O4 — CID 113122126
ethyl 4-[acetyl-[3-(4-methylpiperidin-1-yl)-3-oxopropyl]amino]piperidine-1-carboxylate (PubChem CID 113122126) has the molecular formula C19H33N3O4 and a molecular weight of 367.49 g/mol. Its IUPAC name is ethyl 4-[acetyl-[3-(4-methylpiperidin-1-yl)-3-oxopropyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[acetyl-[3-(4-methylpiperidin-1-yl)-3-oxopropyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 113122126 |
| Molecular Formula | C19H33N3O4 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | ethyl 4-[acetyl-[3-(4-methylpiperidin-1-yl)-3-oxopropyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N(CCC(=O)N2CCC(C)CC2)C(C)=O)CC1 |
| InChI | InChI=1S/C19H33N3O4/c1-4-26-19(25)21-12-7-17(8-13-21)22(16(3)23)14-9-18(24)20-10-5-15(2)6-11-20/h15,17H,4-14H2,1-3H3 |
| InChIKey | RHYUWKBKHFOERE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |