C20H24BrN3O5 — CID 46532388
ethyl 4-[4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoylamino]piperidine-1-carboxylate (PubChem CID 46532388) has the molecular formula C20H24BrN3O5 and a molecular weight of 466.33 g/mol. Its IUPAC name is ethyl 4-[4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 46532388 |
| Molecular Formula | C20H24BrN3O5 |
| Molecular Weight | 466.33 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | ethyl 4-[4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)CCCN2C(=O)c3ccc(Br)cc3C2=O)CC1 |
| InChI | InChI=1S/C20H24BrN3O5/c1-2-29-20(28)23-10-7-14(8-11-23)22-17(25)4-3-9-24-18(26)15-6-5-13(21)12-16(15)19(24)27/h5-6,12,14H,2-4,7-11H2,1H3,(H,22,25) |
| InChIKey | PJZXTTJSUFLPTE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|