C28H24FNOP+ — CID 18972680
[1-(2-fluorophenyl)-2-oxopyrrolidin-3-yl]-triphenylphosphanium (PubChem CID 18972680) has the molecular formula C28H24FNOP+ and a molecular weight of 440.48 g/mol. Its IUPAC name is [1-(2-fluorophenyl)-2-oxopyrrolidin-3-yl]-triphenylphosphanium.
| Compound Name | [1-(2-fluorophenyl)-2-oxopyrrolidin-3-yl]-triphenylphosphanium |
|---|---|
| PubChem CID | 18972680 |
| Molecular Formula | C28H24FNOP+ |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | [1-(2-fluorophenyl)-2-oxopyrrolidin-3-yl]-triphenylphosphanium |
| SMILES | O=C1C([P+](c2ccccc2)(c2ccccc2)c2ccccc2)CCN1c1ccccc1F |
| InChI | InChI=1S/C28H24FNOP/c29-25-18-10-11-19-26(25)30-21-20-27(28(30)31)32(22-12-4-1-5-13-22,23-14-6-2-7-15-23)24-16-8-3-9-17-24/h1-19,27H,20-21H2/q+1 |
| InChIKey | UXBNYQBZSYLOMF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|