C19H22N2O2S — CID 101391819
1-(4-methylphenyl)sulfonyl-4-phenyl-2-propyl-4,5-dihydroimidazole (PubChem CID 101391819) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-4-phenyl-2-propyl-4,5-dihydroimidazole.
| Compound Name | 1-(4-methylphenyl)sulfonyl-4-phenyl-2-propyl-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 101391819 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-4-phenyl-2-propyl-4,5-dihydroimidazole |
| SMILES | CCCC1=NC(c2ccccc2)CN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H22N2O2S/c1-3-7-19-20-18(16-8-5-4-6-9-16)14-21(19)24(22,23)17-12-10-15(2)11-13-17/h4-6,8-13,18H,3,7,14H2,1-2H3 |
| InChIKey | ALDOXQHWISWZEU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |