C15H19NO7S2 — CID 135074084
methyl 1-(4-methylphenyl)sulfonyl-3-methylsulfonyloxy-3,6-dihydro-2H-pyridine-4-carboxylate (PubChem CID 135074084) has the molecular formula C15H19NO7S2 and a molecular weight of 389.45 g/mol. Its IUPAC name is methyl 1-(4-methylphenyl)sulfonyl-3-methylsulfonyloxy-3,6-dihydro-2H-pyridine-4-carboxylate.
| Compound Name | methyl 1-(4-methylphenyl)sulfonyl-3-methylsulfonyloxy-3,6-dihydro-2H-pyridine-4-carboxylate |
|---|---|
| PubChem CID | 135074084 |
| Molecular Formula | C15H19NO7S2 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | methyl 1-(4-methylphenyl)sulfonyl-3-methylsulfonyloxy-3,6-dihydro-2H-pyridine-4-carboxylate |
| SMILES | COC(=O)C1=CCN(S(=O)(=O)c2ccc(C)cc2)CC1OS(C)(=O)=O |
| InChI | InChI=1S/C15H19NO7S2/c1-11-4-6-12(7-5-11)25(20,21)16-9-8-13(15(17)22-2)14(10-16)23-24(3,18)19/h4-8,14H,9-10H2,1-3H3 |
| InChIKey | OTJGJWHNWBPUMZ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|