C11H9ClO3S — CID 95561645
methyl (3R)-6-chloro-4-oxo-2,3-dihydrothiochromene-3-carboxylate (PubChem CID 95561645) has the molecular formula C11H9ClO3S and a molecular weight of 256.71 g/mol. Its IUPAC name is methyl (3R)-6-chloro-4-oxo-2,3-dihydrothiochromene-3-carboxylate.
| Compound Name | methyl (3R)-6-chloro-4-oxo-2,3-dihydrothiochromene-3-carboxylate |
|---|---|
| PubChem CID | 95561645 |
| Molecular Formula | C11H9ClO3S |
| Molecular Weight | 256.71 g/mol |
| Exact Mass | 256.00 |
| IUPAC Name | methyl (3R)-6-chloro-4-oxo-2,3-dihydrothiochromene-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CSc2ccc(Cl)cc2C1=O |
| InChI | InChI=1S/C11H9ClO3S/c1-15-11(14)8-5-16-9-3-2-6(12)4-7(9)10(8)13/h2-4,8H,5H2,1H3/t8-/m1/s1 |
| InChIKey | CKFZKUGJRWLILP-MRVPVSSYSA-N |
| XLogP | 2.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.71 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|