C14H12O5S — CID 125486487
4-[(3S)-6-methyl-4-oxo-2,3-dihydrothiochromen-3-yl]-2,4-dioxobutanoic acid (PubChem CID 125486487) has the molecular formula C14H12O5S and a molecular weight of 292.31 g/mol. Its IUPAC name is 4-[(3S)-6-methyl-4-oxo-2,3-dihydrothiochromen-3-yl]-2,4-dioxobutanoic acid.
| Compound Name | 4-[(3S)-6-methyl-4-oxo-2,3-dihydrothiochromen-3-yl]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 125486487 |
| Molecular Formula | C14H12O5S |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 4-[(3S)-6-methyl-4-oxo-2,3-dihydrothiochromen-3-yl]-2,4-dioxobutanoic acid |
| SMILES | Cc1ccc2c(c1)C(=O)[C@H](C(=O)CC(=O)C(=O)O)CS2 |
| InChI | InChI=1S/C14H12O5S/c1-7-2-3-12-8(4-7)13(17)9(6-20-12)10(15)5-11(16)14(18)19/h2-4,9H,5-6H2,1H3,(H,18,19)/t9-/m0/s1 |
| InChIKey | BYUAUXKMKLLEGV-VIFPVBQESA-N |
| XLogP | 1.51 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|