C17H16ClN3OS — CID 141282515
[(3-benzyl-6-chloro-2,3-dihydrothiochromen-4-ylidene)amino]urea (PubChem CID 141282515) has the molecular formula C17H16ClN3OS and a molecular weight of 345.86 g/mol. Its IUPAC name is [(3-benzyl-6-chloro-2,3-dihydrothiochromen-4-ylidene)amino]urea.
| Compound Name | [(3-benzyl-6-chloro-2,3-dihydrothiochromen-4-ylidene)amino]urea |
|---|---|
| PubChem CID | 141282515 |
| Molecular Formula | C17H16ClN3OS |
| Molecular Weight | 345.86 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | [(3-benzyl-6-chloro-2,3-dihydrothiochromen-4-ylidene)amino]urea |
| SMILES | NC(=O)NN=C1c2cc(Cl)ccc2SCC1Cc1ccccc1 |
| InChI | InChI=1S/C17H16ClN3OS/c18-13-6-7-15-14(9-13)16(20-21-17(19)22)12(10-23-15)8-11-4-2-1-3-5-11/h1-7,9,12H,8,10H2,(H3,19,21,22) |
| InChIKey | BGLQDCPUAAPDRM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.86 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|