C16H21N3O4 — CID 98542372
2-[(1S,2E,5R)-2-(carbamoylhydrazinylidene)-5-phenylmethoxycyclohexyl]acetic acid (PubChem CID 98542372) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 2-[(1S,2E,5R)-2-(carbamoylhydrazinylidene)-5-phenylmethoxycyclohexyl]acetic acid.
| Compound Name | 2-[(1S,2E,5R)-2-(carbamoylhydrazinylidene)-5-phenylmethoxycyclohexyl]acetic acid |
|---|---|
| PubChem CID | 98542372 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 2-[(1S,2E,5R)-2-(carbamoylhydrazinylidene)-5-phenylmethoxycyclohexyl]acetic acid |
| SMILES | NC(=O)N/N=C1\CC[C@@H](OCc2ccccc2)C[C@H]1CC(=O)O |
| InChI | InChI=1S/C16H21N3O4/c17-16(22)19-18-14-7-6-13(8-12(14)9-15(20)21)23-10-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2,(H,20,21)(H3,17,19,22)/b18-14+/t12-,13+/m0/s1 |
| InChIKey | FXTAMIBWOKATPF-SIXPRSDSSA-N |
| XLogP | 1.87 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|