C17H23N3O2 — CID 124767661
[[(2S,3R,5S)-5-acetyl-3-benzyl-2-methylcyclohexylidene]amino]urea (PubChem CID 124767661) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is [[(2S,3R,5S)-5-acetyl-3-benzyl-2-methylcyclohexylidene]amino]urea.
| Compound Name | [[(2S,3R,5S)-5-acetyl-3-benzyl-2-methylcyclohexylidene]amino]urea |
|---|---|
| PubChem CID | 124767661 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | [[(2S,3R,5S)-5-acetyl-3-benzyl-2-methylcyclohexylidene]amino]urea |
| SMILES | CC(=O)[C@@H]1CC(=NNC(N)=O)[C@@H](C)[C@@H](Cc2ccccc2)C1 |
| InChI | InChI=1S/C17H23N3O2/c1-11-14(8-13-6-4-3-5-7-13)9-15(12(2)21)10-16(11)19-20-17(18)22/h3-7,11,14-15H,8-10H2,1-2H3,(H3,18,20,22)/t11-,14-,15-/m0/s1 |
| InChIKey | BHPBRBNOQRVGTP-CQDKDKBSSA-N |
| XLogP | 2.50 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|