C14H16N3O3- — CID 7350566
trans-(1S,2S,3E)-3-(carbamoylhydrazinylidene)-2-methyl-1-phenylcyclopentane-1-carboxylate (PubChem CID 7350566) has the molecular formula C14H16N3O3- and a molecular weight of 274.30 g/mol. Its IUPAC name is trans-(1S,2S,3E)-3-(carbamoylhydrazinylidene)-2-methyl-1-phenylcyclopentane-1-carboxylate.
| Compound Name | trans-(1S,2S,3E)-3-(carbamoylhydrazinylidene)-2-methyl-1-phenylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 7350566 |
| Molecular Formula | C14H16N3O3- |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | trans-(1S,2S,3E)-3-(carbamoylhydrazinylidene)-2-methyl-1-phenylcyclopentane-1-carboxylate |
| SMILES | C[C@@H]1/C(=N/NC(N)=O)CC[C@@]1(C(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C14H17N3O3/c1-9-11(16-17-13(15)20)7-8-14(9,12(18)19)10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,18,19)(H3,15,17,20)/p-1/b16-11+/t9-,14+/m1/s1 |
| InChIKey | OHKMLXFPLWZYAT-TXLRQETESA-M |
| XLogP | 0.13 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|