C19H21N3OSe — CID 11825208
[(E)-(3-methyl-2,6-diphenylselenan-4-ylidene)amino]urea (PubChem CID 11825208) has the molecular formula C19H21N3OSe and a molecular weight of 386.36 g/mol. Its IUPAC name is [(E)-(3-methyl-2,6-diphenylselenan-4-ylidene)amino]urea.
| Compound Name | [(E)-(3-methyl-2,6-diphenylselenan-4-ylidene)amino]urea |
|---|---|
| PubChem CID | 11825208 |
| Molecular Formula | C19H21N3OSe |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | [(E)-(3-methyl-2,6-diphenylselenan-4-ylidene)amino]urea |
| SMILES | CC1/C(=N/NC(N)=O)CC(c2ccccc2)[Se]C1c1ccccc1 |
| InChI | InChI=1S/C19H21N3OSe/c1-13-16(21-22-19(20)23)12-17(14-8-4-2-5-9-14)24-18(13)15-10-6-3-7-11-15/h2-11,13,17-18H,12H2,1H3,(H3,20,22,23)/b21-16+ |
| InChIKey | OADXLSKLNMVSTG-LTGZKZEYSA-N |
| XLogP | 3.24 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|