C21H25N4O+ — CID 50944144
[[(1R,2S,4S,5R)-2,4-diphenyl-3-azoniabicyclo[3.3.1]nonan-9-ylidene]amino]urea (PubChem CID 50944144) has the molecular formula C21H25N4O+ and a molecular weight of 349.46 g/mol. Its IUPAC name is [[(1R,2S,4S,5R)-2,4-diphenyl-3-azoniabicyclo[3.3.1]nonan-9-ylidene]amino]urea.
| Compound Name | [[(1R,2S,4S,5R)-2,4-diphenyl-3-azoniabicyclo[3.3.1]nonan-9-ylidene]amino]urea |
|---|---|
| PubChem CID | 50944144 |
| Molecular Formula | C21H25N4O+ |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | [[(1R,2S,4S,5R)-2,4-diphenyl-3-azoniabicyclo[3.3.1]nonan-9-ylidene]amino]urea |
| SMILES | NC(=O)NN=C1[C@@H]2CCC[C@@H]1[C@@H](c1ccccc1)[NH2+][C@@H]2c1ccccc1 |
| InChI | InChI=1S/C21H24N4O/c22-21(26)25-24-20-16-12-7-13-17(20)19(15-10-5-2-6-11-15)23-18(16)14-8-3-1-4-9-14/h1-6,8-11,16-19,23H,7,12-13H2,(H3,22,25,26)/p+1/t16-,17-,18-,19-/m1/s1 |
| InChIKey | BNJXNKFPPJGIBR-NCXUSEDFSA-O |
| XLogP | 2.49 |
| TPSA | 84.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|