C16H21N3OSe — CID 10337928
[(E)-[(2S,4aS,8aS)-2-phenyl-2,3,4a,5,6,7,8,8a-octahydroselenochromen-4-ylidene]amino]urea (PubChem CID 10337928) has the molecular formula C16H21N3OSe and a molecular weight of 350.32 g/mol. Its IUPAC name is [(E)-[(2S,4aS,8aS)-2-phenyl-2,3,4a,5,6,7,8,8a-octahydroselenochromen-4-ylidene]amino]urea.
| Compound Name | [(E)-[(2S,4aS,8aS)-2-phenyl-2,3,4a,5,6,7,8,8a-octahydroselenochromen-4-ylidene]amino]urea |
|---|---|
| PubChem CID | 10337928 |
| Molecular Formula | C16H21N3OSe |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | [(E)-[(2S,4aS,8aS)-2-phenyl-2,3,4a,5,6,7,8,8a-octahydroselenochromen-4-ylidene]amino]urea |
| SMILES | NC(=O)N/N=C1\C[C@@H](c2ccccc2)[Se][C@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C16H21N3OSe/c17-16(20)19-18-13-10-15(11-6-2-1-3-7-11)21-14-9-5-4-8-12(13)14/h1-3,6-7,12,14-15H,4-5,8-10H2,(H3,17,19,20)/b18-13+/t12-,14-,15-/m0/s1 |
| InChIKey | AMHYXIZPSYVAQC-JWEOJCAJSA-N |
| XLogP | 2.84 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|