C16H21N3SSe — CID 100978173
[(Z)-[(2R,4aS,8aS)-2-phenyl-2,3,4a,5,6,7,8,8a-octahydroselenochromen-4-ylidene]amino]thiourea (PubChem CID 100978173) has the molecular formula C16H21N3SSe and a molecular weight of 366.39 g/mol. Its IUPAC name is [(Z)-[(2R,4aS,8aS)-2-phenyl-2,3,4a,5,6,7,8,8a-octahydroselenochromen-4-ylidene]amino]thiourea.
| Compound Name | [(Z)-[(2R,4aS,8aS)-2-phenyl-2,3,4a,5,6,7,8,8a-octahydroselenochromen-4-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 100978173 |
| Molecular Formula | C16H21N3SSe |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | [(Z)-[(2R,4aS,8aS)-2-phenyl-2,3,4a,5,6,7,8,8a-octahydroselenochromen-4-ylidene]amino]thiourea |
| SMILES | NC(=S)N/N=C1/C[C@H](c2ccccc2)[Se][C@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C16H21N3SSe/c17-16(20)19-18-13-10-15(11-6-2-1-3-7-11)21-14-9-5-4-8-12(13)14/h1-3,6-7,12,14-15H,4-5,8-10H2,(H3,17,19,20)/b18-13-/t12-,14-,15+/m0/s1 |
| InChIKey | NDKKZUJAFWGNHM-OWOVBOPOSA-N |
| XLogP | 3.00 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|