C13H19N4S+ — CID 8008736
[(Z)-[(2R)-2-(1-methylpyridin-1-ium-2-yl)cyclohexylidene]amino]thiourea (PubChem CID 8008736) has the molecular formula C13H19N4S+ and a molecular weight of 263.39 g/mol. Its IUPAC name is [(Z)-[(2R)-2-(1-methylpyridin-1-ium-2-yl)cyclohexylidene]amino]thiourea.
| Compound Name | [(Z)-[(2R)-2-(1-methylpyridin-1-ium-2-yl)cyclohexylidene]amino]thiourea |
|---|---|
| PubChem CID | 8008736 |
| Molecular Formula | C13H19N4S+ |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | [(Z)-[(2R)-2-(1-methylpyridin-1-ium-2-yl)cyclohexylidene]amino]thiourea |
| SMILES | C[n+]1ccccc1[C@H]1CCCC/C1=N/NC(N)=S |
| InChI | InChI=1S/C13H18N4S/c1-17-9-5-4-8-12(17)10-6-2-3-7-11(10)15-16-13(14)18/h4-5,8-10H,2-3,6-7H2,1H3,(H2-,14,16,18)/p+1/b15-11-/t10-/m0/s1 |
| InChIKey | RUWVOGUYRTZNEA-NVRAKJRWSA-O |
| XLogP | 1.36 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|