C20H29N3S — CID 7800933
1-benzyl-3-[[(2S)-2-cyclohexylcyclohexylidene]amino]thiourea (PubChem CID 7800933) has the molecular formula C20H29N3S and a molecular weight of 343.54 g/mol. Its IUPAC name is 1-benzyl-3-[[(2S)-2-cyclohexylcyclohexylidene]amino]thiourea.
| Compound Name | 1-benzyl-3-[[(2S)-2-cyclohexylcyclohexylidene]amino]thiourea |
|---|---|
| PubChem CID | 7800933 |
| Molecular Formula | C20H29N3S |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 1-benzyl-3-[[(2S)-2-cyclohexylcyclohexylidene]amino]thiourea |
| SMILES | S=C(NCc1ccccc1)NN=C1CCCC[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C20H29N3S/c24-20(21-15-16-9-3-1-4-10-16)23-22-19-14-8-7-13-18(19)17-11-5-2-6-12-17/h1,3-4,9-10,17-18H,2,5-8,11-15H2,(H2,21,23,24)/t18-/m0/s1 |
| InChIKey | ZUHGTTMPXIBJHE-SFHVURJKSA-N |
| XLogP | 4.78 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|