C18H25N3S — CID 8746915
1-benzyl-3-[(E)-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]thiourea (PubChem CID 8746915) has the molecular formula C18H25N3S and a molecular weight of 315.49 g/mol. Its IUPAC name is 1-benzyl-3-[(E)-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]thiourea.
| Compound Name | 1-benzyl-3-[(E)-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]thiourea |
|---|---|
| PubChem CID | 8746915 |
| Molecular Formula | C18H25N3S |
| Molecular Weight | 315.49 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 1-benzyl-3-[(E)-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]thiourea |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)/C(=N/NC(=S)NCc1ccccc1)C2 |
| InChI | InChI=1S/C18H25N3S/c1-17(2)14-9-10-18(17,3)15(11-14)20-21-16(22)19-12-13-7-5-4-6-8-13/h4-8,14H,9-12H2,1-3H3,(H2,19,21,22)/b20-15+/t14-,18+/m1/s1 |
| InChIKey | GDSHJDFAQZRBHM-NTPYYIONSA-N |
| XLogP | 3.85 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|