About [(E)-[(1R,10R)-2-bicyclo[8.1.0]undecanylidene]amino]urea
[(E)-[(1R,10R)-2-bicyclo[8.1.0]undecanylidene]amino]urea (PubChem CID 11896369) has the molecular formula C12H21N3O
and a molecular weight of 223.32 g/mol. Its IUPAC name is [(E)-[(1R,10R)-2-bicyclo[8.1.0]undecanylidene]amino]urea.
Molecular Properties
| Compound Name | [(E)-[(1R,10R)-2-bicyclo[8.1.0]undecanylidene]amino]urea |
| PubChem CID | 11896369 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | [(E)-[(1R,10R)-2-bicyclo[8.1.0]undecanylidene]amino]urea |
| SMILES | NC(=O)N/N=C1\CCCCCCC[C@@H]2C[C@@H]12 |
| InChI | InChI=1S/C12H21N3O/c13-12(16)15-14-11-7-5-3-1-2-4-6-9-8-10(9)11/h9-10H,1-8H2,(H3,13,15,16)/b14-11+/t9-,10-/m1/s1 |
| InChIKey | JTXTZAHECBFCCD-FHQJZVNASA-N |
| XLogP | 2.39 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-[(1R,10R)-2-bicyclo[8.1.0]undecanylidene]amino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-[(1R,10R)-2-bicyclo[8.1.0]undecanylidene]amino]urea?
The IUPAC name of [(E)-[(1R,10R)-2-bicyclo[8.1.0]undecanylidene]amino]urea (CID 11896369) is [(E)-[(1R,10R)-2-bicyclo[8.1.0]undecanylidene]amino]urea.
What is the SMILES notation for [(E)-[(1R,10R)-2-bicyclo[8.1.0]undecanylidene]amino]urea?
The canonical SMILES for [(E)-[(1R,10R)-2-bicyclo[8.1.0]undecanylidene]amino]urea is NC(=O)N/N=C1\CCCCCCC[C@@H]2C[C@@H]12.
What is the InChIKey of [(E)-[(1R,10R)-2-bicyclo[8.1.0]undecanylidene]amino]urea?
The InChIKey is JTXTZAHECBFCCD-FHQJZVNASA-N. The full InChI is InChI=1S/C12H21N3O/c13-12(16)15-14-11-7-5-3-1-2-4-6-9-8-10(9)11/h9-10H,1-8H2,(H3,13,15,16)/b14-11+/t9-,10-/m1/s1.
What are the key properties of [(E)-[(1R,10R)-2-bicyclo[8.1.0]undecanylidene]amino]urea?
[(E)-[(1R,10R)-2-bicyclo[8.1.0]undecanylidene]amino]urea has a molecular weight of 223.32 g/mol, XLogP of 2.39, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-[(1R,10R)-2-bicyclo[8.1.0]undecanylidene]amino]urea is sourced from PubChem (CID 11896369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).