C13H18N6O2 — CID 129421568
[[(1R,2S,5S,6S,8R,9R)-11-(carbamoylhydrazinylidene)-3-tetracyclo[6.3.0.02,6.05,9]undecanylidene]amino]urea (PubChem CID 129421568) has the molecular formula C13H18N6O2 and a molecular weight of 290.33 g/mol. Its IUPAC name is [[(1R,2S,5S,6S,8R,9R)-11-(carbamoylhydrazinylidene)-3-tetracyclo[6.3.0.02,6.05,9]undecanylidene]amino]urea.
| Compound Name | [[(1R,2S,5S,6S,8R,9R)-11-(carbamoylhydrazinylidene)-3-tetracyclo[6.3.0.02,6.05,9]undecanylidene]amino]urea |
|---|---|
| PubChem CID | 129421568 |
| Molecular Formula | C13H18N6O2 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | [[(1R,2S,5S,6S,8R,9R)-11-(carbamoylhydrazinylidene)-3-tetracyclo[6.3.0.02,6.05,9]undecanylidene]amino]urea |
| SMILES | NC(=O)NN=C1C[C@@H]2[C@@H]3CC(=NNC(N)=O)[C@H]4[C@H]3C[C@H]2[C@@H]14 |
| InChI | InChI=1S/C13H18N6O2/c14-12(20)18-16-8-2-4-5-3-9(17-19-13(15)21)11-7(5)1-6(4)10(8)11/h4-7,10-11H,1-3H2,(H3,14,18,20)(H3,15,19,21)/t4-,5+,6-,7+,10+,11- |
| InChIKey | VGAPAJONVCYASD-LDGYJWSESA-N |
| XLogP | -0.04 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|