C10H13N3O — CID 98541116
[(E)-[(1S,2S,3R,4S,6R,7S)-8-tetracyclo[4.3.0.02,4.03,7]nonanylidene]amino]urea (PubChem CID 98541116) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is [(E)-[(1S,2S,3R,4S,6R,7S)-8-tetracyclo[4.3.0.02,4.03,7]nonanylidene]amino]urea.
| Compound Name | [(E)-[(1S,2S,3R,4S,6R,7S)-8-tetracyclo[4.3.0.02,4.03,7]nonanylidene]amino]urea |
|---|---|
| PubChem CID | 98541116 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | [(E)-[(1S,2S,3R,4S,6R,7S)-8-tetracyclo[4.3.0.02,4.03,7]nonanylidene]amino]urea |
| SMILES | NC(=O)N/N=C1\C[C@H]2[C@H]3C[C@H]4[C@@H]2[C@@H]4[C@@H]13 |
| InChI | InChI=1S/C10H13N3O/c11-10(14)13-12-6-2-4-3-1-5-7(4)9(5)8(3)6/h3-5,7-9H,1-2H2,(H3,11,13,14)/b12-6+/t3-,4+,5+,7-,8-,9-/m1/s1 |
| InChIKey | GBWINHSBPKVUGH-MAVQNYRUSA-N |
| XLogP | 0.54 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|