C10H19N3OS — CID 7369295
[[(2R,3S,6S)-2-ethyl-3,6-dimethylthian-4-ylidene]amino]urea (PubChem CID 7369295) has the molecular formula C10H19N3OS and a molecular weight of 229.35 g/mol. Its IUPAC name is [[(2R,3S,6S)-2-ethyl-3,6-dimethylthian-4-ylidene]amino]urea.
| Compound Name | [[(2R,3S,6S)-2-ethyl-3,6-dimethylthian-4-ylidene]amino]urea |
|---|---|
| PubChem CID | 7369295 |
| Molecular Formula | C10H19N3OS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | [[(2R,3S,6S)-2-ethyl-3,6-dimethylthian-4-ylidene]amino]urea |
| SMILES | CC[C@H]1S[C@@H](C)CC(=NNC(N)=O)[C@@H]1C |
| InChI | InChI=1S/C10H19N3OS/c1-4-9-7(3)8(5-6(2)15-9)12-13-10(11)14/h6-7,9H,4-5H2,1-3H3,(H3,11,13,14)/t6-,7-,9+/m0/s1 |
| InChIKey | CXEKRAUJXURPPU-ACLDMZEESA-N |
| XLogP | 1.95 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|