C19H21N3O2 — CID 92856454
[(E)-[(4R)-6-methoxy-4-methyl-4-phenyl-2,3-dihydronaphthalen-1-ylidene]amino]urea (PubChem CID 92856454) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is [(E)-[(4R)-6-methoxy-4-methyl-4-phenyl-2,3-dihydronaphthalen-1-ylidene]amino]urea.
| Compound Name | [(E)-[(4R)-6-methoxy-4-methyl-4-phenyl-2,3-dihydronaphthalen-1-ylidene]amino]urea |
|---|---|
| PubChem CID | 92856454 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | [(E)-[(4R)-6-methoxy-4-methyl-4-phenyl-2,3-dihydronaphthalen-1-ylidene]amino]urea |
| SMILES | COc1ccc2c(c1)[C@@](C)(c1ccccc1)CC/C2=N\NC(N)=O |
| InChI | InChI=1S/C19H21N3O2/c1-19(13-6-4-3-5-7-13)11-10-17(21-22-18(20)23)15-9-8-14(24-2)12-16(15)19/h3-9,12H,10-11H2,1-2H3,(H3,20,22,23)/b21-17+/t19-/m1/s1 |
| InChIKey | VIVJIWYZBZUTOD-OXMAITBSSA-N |
| XLogP | 3.17 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|