C15H22N2O — CID 125464130
N'-[(1S,2S)-2-benzylcyclohexyl]acetohydrazide (PubChem CID 125464130) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is N'-[(1S,2S)-2-benzylcyclohexyl]acetohydrazide.
| Compound Name | N'-[(1S,2S)-2-benzylcyclohexyl]acetohydrazide |
|---|---|
| PubChem CID | 125464130 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | N'-[(1S,2S)-2-benzylcyclohexyl]acetohydrazide |
| SMILES | CC(=O)NN[C@H]1CCCC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C15H22N2O/c1-12(18)16-17-15-10-6-5-9-14(15)11-13-7-3-2-4-8-13/h2-4,7-8,14-15,17H,5-6,9-11H2,1H3,(H,16,18)/t14-,15-/m0/s1 |
| InChIKey | GETAJCJKNNOSFM-GJZGRUSLSA-N |
| XLogP | 2.43 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|