C21H27ClN2O — CID 119317648
4-(aminomethyl)-N-(2-benzylcyclohexyl)benzamide;hydrochloride (PubChem CID 119317648) has the molecular formula C21H27ClN2O and a molecular weight of 358.91 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(2-benzylcyclohexyl)benzamide;hydrochloride.
| Compound Name | 4-(aminomethyl)-N-(2-benzylcyclohexyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119317648 |
| Molecular Formula | C21H27ClN2O |
| Molecular Weight | 358.91 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 4-(aminomethyl)-N-(2-benzylcyclohexyl)benzamide;hydrochloride |
| SMILES | Cl.NCc1ccc(C(=O)NC2CCCCC2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H26N2O.ClH/c22-15-17-10-12-18(13-11-17)21(24)23-20-9-5-4-8-19(20)14-16-6-2-1-3-7-16;/h1-3,6-7,10-13,19-20H,4-5,8-9,14-15,22H2,(H,23,24);1H |
| InChIKey | VZTPNRNRLHSLFI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.91 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |