C21H23NO4 — CID 119185869
2-[3-[(2-benzylcyclopentyl)carbamoyl]phenoxy]acetic acid (PubChem CID 119185869) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is 2-[3-[(2-benzylcyclopentyl)carbamoyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[(2-benzylcyclopentyl)carbamoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 119185869 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 2-[3-[(2-benzylcyclopentyl)carbamoyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1cccc(C(=O)NC2CCCC2Cc2ccccc2)c1 |
| InChI | InChI=1S/C21H23NO4/c23-20(24)14-26-18-10-4-9-17(13-18)21(25)22-19-11-5-8-16(19)12-15-6-2-1-3-7-15/h1-4,6-7,9-10,13,16,19H,5,8,11-12,14H2,(H,22,25)(H,23,24) |
| InChIKey | AYNJXCFTSSHONR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |