C14H17NO7S — CID 136552214
2-[3-[(4-methoxy-1,1-dioxothiolan-3-yl)carbamoyl]phenoxy]acetic acid (PubChem CID 136552214) has the molecular formula C14H17NO7S and a molecular weight of 343.36 g/mol. Its IUPAC name is 2-[3-[(4-methoxy-1,1-dioxothiolan-3-yl)carbamoyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[(4-methoxy-1,1-dioxothiolan-3-yl)carbamoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 136552214 |
| Molecular Formula | C14H17NO7S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 2-[3-[(4-methoxy-1,1-dioxothiolan-3-yl)carbamoyl]phenoxy]acetic acid |
| SMILES | COC1CS(=O)(=O)CC1NC(=O)c1cccc(OCC(=O)O)c1 |
| InChI | InChI=1S/C14H17NO7S/c1-21-12-8-23(19,20)7-11(12)15-14(18)9-3-2-4-10(5-9)22-6-13(16)17/h2-5,11-12H,6-8H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | XOOWSKDHIXBVPT-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |