C17H26N2O4 — CID 110145684
N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclohexyl]-3-[2-(methylamino)ethoxy]benzamide (PubChem CID 110145684) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclohexyl]-3-[2-(methylamino)ethoxy]benzamide.
| Compound Name | N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclohexyl]-3-[2-(methylamino)ethoxy]benzamide |
|---|---|
| PubChem CID | 110145684 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclohexyl]-3-[2-(methylamino)ethoxy]benzamide |
| SMILES | CNCCOc1cccc(C(=O)N[C@@H]2CCC[C@@H](OC)[C@@H]2O)c1 |
| InChI | InChI=1S/C17H26N2O4/c1-18-9-10-23-13-6-3-5-12(11-13)17(21)19-14-7-4-8-15(22-2)16(14)20/h3,5-6,11,14-16,18,20H,4,7-10H2,1-2H3,(H,19,21)/t14-,15-,16-/m1/s1 |
| InChIKey | WUQBCFIXZGJZHC-BZUAXINKSA-N |
| XLogP | 0.94 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|