C15H22N2O4 — CID 110145638
4-(2-aminoethoxy)-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclopentyl]benzamide (PubChem CID 110145638) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 4-(2-aminoethoxy)-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclopentyl]benzamide.
| Compound Name | 4-(2-aminoethoxy)-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclopentyl]benzamide |
|---|---|
| PubChem CID | 110145638 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 4-(2-aminoethoxy)-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclopentyl]benzamide |
| SMILES | CO[C@@H]1CC[C@@H](NC(=O)c2ccc(OCCN)cc2)[C@H]1O |
| InChI | InChI=1S/C15H22N2O4/c1-20-13-7-6-12(14(13)18)17-15(19)10-2-4-11(5-3-10)21-9-8-16/h2-5,12-14,18H,6-9,16H2,1H3,(H,17,19)/t12-,13-,14-/m1/s1 |
| InChIKey | VZTJYCAWCAVDGQ-MGPQQGTHSA-N |
| XLogP | 0.29 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |