C19H21NO4 — CID 155902479
N-[(1R,2R,3S,4R)-2,3-dihydroxy-4-phenoxycyclohexyl]benzamide (PubChem CID 155902479) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is N-[(1R,2R,3S,4R)-2,3-dihydroxy-4-phenoxycyclohexyl]benzamide.
| Compound Name | N-[(1R,2R,3S,4R)-2,3-dihydroxy-4-phenoxycyclohexyl]benzamide |
|---|---|
| PubChem CID | 155902479 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | N-[(1R,2R,3S,4R)-2,3-dihydroxy-4-phenoxycyclohexyl]benzamide |
| SMILES | O=C(N[C@@H]1CC[C@@H](Oc2ccccc2)[C@@H](O)[C@@H]1O)c1ccccc1 |
| InChI | InChI=1S/C19H21NO4/c21-17-15(20-19(23)13-7-3-1-4-8-13)11-12-16(18(17)22)24-14-9-5-2-6-10-14/h1-10,15-18,21-22H,11-12H2,(H,20,23)/t15-,16-,17-,18-/m1/s1 |
| InChIKey | CVHNHIVUXXLGIU-BRSBDYLESA-N |
| XLogP | 1.75 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |