C22H29N7O4 — CID 110135216
4-(3-aminopropoxy)-N-[(1R,2S,3S,4R)-2,3-dihydroxy-4-[6-(methylamino)purin-9-yl]cyclohexyl]benzamide (PubChem CID 110135216) has the molecular formula C22H29N7O4 and a molecular weight of 455.52 g/mol. Its IUPAC name is 4-(3-aminopropoxy)-N-[(1R,2S,3S,4R)-2,3-dihydroxy-4-[6-(methylamino)purin-9-yl]cyclohexyl]benzamide.
| Compound Name | 4-(3-aminopropoxy)-N-[(1R,2S,3S,4R)-2,3-dihydroxy-4-[6-(methylamino)purin-9-yl]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 110135216 |
| Molecular Formula | C22H29N7O4 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 4-(3-aminopropoxy)-N-[(1R,2S,3S,4R)-2,3-dihydroxy-4-[6-(methylamino)purin-9-yl]cyclohexyl]benzamide |
| SMILES | CNc1ncnc2c1ncn2[C@@H]1CC[C@@H](NC(=O)c2ccc(OCCCN)cc2)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H29N7O4/c1-24-20-17-21(26-11-25-20)29(12-27-17)16-8-7-15(18(30)19(16)31)28-22(32)13-3-5-14(6-4-13)33-10-2-9-23/h3-6,11-12,15-16,18-19,30-31H,2,7-10,23H2,1H3,(H,28,32)(H,24,25,26)/t15-,16-,18+,19+/m1/s1 |
| InChIKey | LTROHFCBGAASHO-FPAYPSAMSA-N |
| XLogP | 0.45 |
| TPSA | 160.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|