C19H28N6O5 — CID 110154379
5-[[(1R,2S,3S,4R)-2,3-dihydroxy-4-[6-(methylamino)purin-9-yl]cyclohexyl]amino]-3,3-dimethyl-5-oxopentanoic acid (PubChem CID 110154379) has the molecular formula C19H28N6O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is 5-[[(1R,2S,3S,4R)-2,3-dihydroxy-4-[6-(methylamino)purin-9-yl]cyclohexyl]amino]-3,3-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-[[(1R,2S,3S,4R)-2,3-dihydroxy-4-[6-(methylamino)purin-9-yl]cyclohexyl]amino]-3,3-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 110154379 |
| Molecular Formula | C19H28N6O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 5-[[(1R,2S,3S,4R)-2,3-dihydroxy-4-[6-(methylamino)purin-9-yl]cyclohexyl]amino]-3,3-dimethyl-5-oxopentanoic acid |
| SMILES | CNc1ncnc2c1ncn2[C@@H]1CC[C@@H](NC(=O)CC(C)(C)CC(=O)O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C19H28N6O5/c1-19(2,7-13(27)28)6-12(26)24-10-4-5-11(16(30)15(10)29)25-9-23-14-17(20-3)21-8-22-18(14)25/h8-11,15-16,29-30H,4-7H2,1-3H3,(H,24,26)(H,27,28)(H,20,21,22)/t10-,11-,15+,16+/m1/s1 |
| InChIKey | OIYMBGKECYAOTN-XYPYXGAPSA-N |
| XLogP | 0.30 |
| TPSA | 162.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |