C19H20N6O2 — CID 24756300
(3aR,4R,7S,7aS)-4-[6-(methylamino)purin-9-yl]-3-phenyl-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazol-7-ol (PubChem CID 24756300) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is (3aR,4R,7S,7aS)-4-[6-(methylamino)purin-9-yl]-3-phenyl-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazol-7-ol.
| Compound Name | (3aR,4R,7S,7aS)-4-[6-(methylamino)purin-9-yl]-3-phenyl-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazol-7-ol |
|---|---|
| PubChem CID | 24756300 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | (3aR,4R,7S,7aS)-4-[6-(methylamino)purin-9-yl]-3-phenyl-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazol-7-ol |
| SMILES | CNc1ncnc2c1ncn2[C@@H]1CC[C@H](O)[C@H]2ON=C(c3ccccc3)[C@H]21 |
| InChI | InChI=1S/C19H20N6O2/c1-20-18-16-19(22-9-21-18)25(10-23-16)12-7-8-13(26)17-14(12)15(24-27-17)11-5-3-2-4-6-11/h2-6,9-10,12-14,17,26H,7-8H2,1H3,(H,20,21,22)/t12-,13+,14-,17-/m1/s1 |
| InChIKey | VCFQWEOFZNTSKP-UMPJEAMMSA-N |
| XLogP | 1.98 |
| TPSA | 97.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |