C12H17N5O3 — CID 10612692
(2R,3S,5S)-2-(hydroxymethyl)-5-[6-(methylamino)purin-9-yl]oxan-3-ol (PubChem CID 10612692) has the molecular formula C12H17N5O3 and a molecular weight of 279.30 g/mol. Its IUPAC name is (2R,3S,5S)-2-(hydroxymethyl)-5-[6-(methylamino)purin-9-yl]oxan-3-ol.
| Compound Name | (2R,3S,5S)-2-(hydroxymethyl)-5-[6-(methylamino)purin-9-yl]oxan-3-ol |
|---|---|
| PubChem CID | 10612692 |
| Molecular Formula | C12H17N5O3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | (2R,3S,5S)-2-(hydroxymethyl)-5-[6-(methylamino)purin-9-yl]oxan-3-ol |
| SMILES | CNc1ncnc2c1ncn2[C@@H]1CO[C@H](CO)[C@@H](O)C1 |
| InChI | InChI=1S/C12H17N5O3/c1-13-11-10-12(15-5-14-11)17(6-16-10)7-2-8(19)9(3-18)20-4-7/h5-9,18-19H,2-4H2,1H3,(H,13,14,15)/t7-,8-,9+/m0/s1 |
| InChIKey | QWSYPKODASHNGZ-XHNCKOQMSA-N |
| XLogP | -0.45 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |