C18H16ClN5O2 — CID 24854057
[(3aR,4R,6R,6aS)-4-(6-chloropurin-9-yl)-3-phenyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazol-6-yl]methanol (PubChem CID 24854057) has the molecular formula C18H16ClN5O2 and a molecular weight of 369.81 g/mol. Its IUPAC name is [(3aR,4R,6R,6aS)-4-(6-chloropurin-9-yl)-3-phenyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazol-6-yl]methanol.
| Compound Name | [(3aR,4R,6R,6aS)-4-(6-chloropurin-9-yl)-3-phenyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazol-6-yl]methanol |
|---|---|
| PubChem CID | 24854057 |
| Molecular Formula | C18H16ClN5O2 |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | [(3aR,4R,6R,6aS)-4-(6-chloropurin-9-yl)-3-phenyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazol-6-yl]methanol |
| SMILES | OC[C@H]1C[C@@H](n2cnc3c(Cl)ncnc32)[C@@H]2C(c3ccccc3)=NO[C@H]12 |
| InChI | InChI=1S/C18H16ClN5O2/c19-17-15-18(21-8-20-17)24(9-22-15)12-6-11(7-25)16-13(12)14(23-26-16)10-4-2-1-3-5-10/h1-5,8-9,11-13,16,25H,6-7H2/t11-,12-,13-,16-/m1/s1 |
| InChIKey | WJURDDDTACZPPM-BRXULGCHSA-N |
| XLogP | 2.45 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |