C10H11ClN4OS — CID 10468389
[(2R,3S)-2-(6-chloropurin-9-yl)thiolan-3-yl]methanol (PubChem CID 10468389) has the molecular formula C10H11ClN4OS and a molecular weight of 270.75 g/mol. Its IUPAC name is [(2R,3S)-2-(6-chloropurin-9-yl)thiolan-3-yl]methanol.
| Compound Name | [(2R,3S)-2-(6-chloropurin-9-yl)thiolan-3-yl]methanol |
|---|---|
| PubChem CID | 10468389 |
| Molecular Formula | C10H11ClN4OS |
| Molecular Weight | 270.75 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | [(2R,3S)-2-(6-chloropurin-9-yl)thiolan-3-yl]methanol |
| SMILES | OC[C@@H]1CCS[C@H]1n1cnc2c(Cl)ncnc21 |
| InChI | InChI=1S/C10H11ClN4OS/c11-8-7-9(13-4-12-8)15(5-14-7)10-6(3-16)1-2-17-10/h4-6,10,16H,1-3H2/t6-,10+/m0/s1 |
| InChIKey | JPKTXTHIJCACCJ-QUBYGPBYSA-N |
| XLogP | 1.72 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.75 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |