C12H15ClN4O — CID 15450648
[(1S,2R)-2-[(6-chloropurin-9-yl)methyl]cyclopentyl]methanol (PubChem CID 15450648) has the molecular formula C12H15ClN4O and a molecular weight of 266.73 g/mol. Its IUPAC name is [(1S,2R)-2-[(6-chloropurin-9-yl)methyl]cyclopentyl]methanol.
| Compound Name | [(1S,2R)-2-[(6-chloropurin-9-yl)methyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 15450648 |
| Molecular Formula | C12H15ClN4O |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | [(1S,2R)-2-[(6-chloropurin-9-yl)methyl]cyclopentyl]methanol |
| SMILES | OC[C@H]1CCC[C@H]1Cn1cnc2c(Cl)ncnc21 |
| InChI | InChI=1S/C12H15ClN4O/c13-11-10-12(15-6-14-11)17(7-16-10)4-8-2-1-3-9(8)5-18/h6-9,18H,1-5H2/t8-,9+/m0/s1 |
| InChIKey | HQVGJBXMHOKQJH-DTWKUNHWSA-N |
| XLogP | 1.89 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |