C9H9ClN4O2S — CID 54345493
[(2S,4R)-4-(6-chloropurin-9-yl)-1,3-oxathiolan-2-yl]methanol (PubChem CID 54345493) has the molecular formula C9H9ClN4O2S and a molecular weight of 272.72 g/mol. Its IUPAC name is [(2S,4R)-4-(6-chloropurin-9-yl)-1,3-oxathiolan-2-yl]methanol.
| Compound Name | [(2S,4R)-4-(6-chloropurin-9-yl)-1,3-oxathiolan-2-yl]methanol |
|---|---|
| PubChem CID | 54345493 |
| Molecular Formula | C9H9ClN4O2S |
| Molecular Weight | 272.72 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | [(2S,4R)-4-(6-chloropurin-9-yl)-1,3-oxathiolan-2-yl]methanol |
| SMILES | OC[C@H]1OC[C@H](n2cnc3c(Cl)ncnc32)S1 |
| InChI | InChI=1S/C9H9ClN4O2S/c10-8-7-9(12-3-11-8)14(4-13-7)5-2-16-6(1-15)17-5/h3-6,15H,1-2H2/t5-,6+/m1/s1 |
| InChIKey | UCAKLYVNTOXEBS-RITPCOANSA-N |
| XLogP | 1.06 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.72 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |