C11H13ClN4O2 — CID 102417514
2-[(2S,3R)-3-(6-chloropurin-9-yl)oxolan-2-yl]ethanol (PubChem CID 102417514) has the molecular formula C11H13ClN4O2 and a molecular weight of 268.70 g/mol. Its IUPAC name is 2-[(2S,3R)-3-(6-chloropurin-9-yl)oxolan-2-yl]ethanol.
| Compound Name | 2-[(2S,3R)-3-(6-chloropurin-9-yl)oxolan-2-yl]ethanol |
|---|---|
| PubChem CID | 102417514 |
| Molecular Formula | C11H13ClN4O2 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 2-[(2S,3R)-3-(6-chloropurin-9-yl)oxolan-2-yl]ethanol |
| SMILES | OCC[C@@H]1OCC[C@H]1n1cnc2c(Cl)ncnc21 |
| InChI | InChI=1S/C11H13ClN4O2/c12-10-9-11(14-5-13-10)16(6-15-9)7-2-4-18-8(7)1-3-17/h5-8,17H,1-4H2/t7-,8+/m1/s1 |
| InChIKey | XNUCLGAANWUQBW-SFYZADRCSA-N |
| XLogP | 1.19 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |